| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:30 UTC |
|---|
| Update Date | 2025-03-21 18:03:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00044574 |
|---|
| Frequency | 75.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18O6 |
|---|
| Molecular Mass | 270.1103 |
|---|
| SMILES | OC1C(O)C(O)C(OCc2ccccc2)C(O)C1O |
|---|
| InChI Key | RWDNROPIZFGEAU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzylethers |
|---|
| Direct Parent | benzylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | cyclitols and derivativescyclohexanolsdialkyl ethershydrocarbon derivatives |
|---|
| Substituents | alcoholetherbenzylethercyclohexanolcyclitol or derivativescyclic alcoholdialkyl etheraromatic homomonocyclic compoundorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
