| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:32 UTC |
|---|
| Update Date | 2025-03-21 18:03:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00044628 |
|---|
| Frequency | 75.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14O4 |
|---|
| Molecular Mass | 186.0892 |
|---|
| SMILES | CC1C(=O)OC(C(=O)O)C(C)C1C |
|---|
| InChI Key | PZCXGRRPIDGERE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid esterscarboxylic acidsdelta valerolactonesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesoxacyclic compoundsoxanes |
|---|
| Substituents | carbonyl groupcarboxylic acidpyran carboxylic acid or derivativesdelta valerolactonecarboxylic acid derivativelactoneoxacycleorganic oxideorganic oxygen compoundcarboxylic acid esteraliphatic heteromonocyclic compounddicarboxylic acid or derivativeshydrocarbon derivativeoxanedelta_valerolactoneorganooxygen compound |
|---|
