| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:52:33 UTC |
|---|
| Update Date | 2025-03-21 18:03:30 UTC |
|---|
| HMDB ID | HMDB0246094 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00044693 |
|---|
| Name | 3'-Deoxythymidine |
|---|
| Frequency | 75.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N2O4 |
|---|
| Molecular Mass | 226.0954 |
|---|
| SMILES | Cc1cn(C2CCC(CO)O2)c(=O)[nH]c1=O |
|---|
| InChI Key | XKKCQTLDIPIRQD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | alcoholvinylogous amidecarbonic acid derivativelactamaromatic heteromonocyclic compoundazacycletetrahydrofuranheteroaromatic compoundpyrimidoneoxacycleorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundprimary alcoholorganooxygen compound |
|---|
