| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:34 UTC |
|---|
| Update Date | 2025-03-21 18:03:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00044724 |
|---|
| Frequency | 75.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H23NO3 |
|---|
| Molecular Mass | 313.1678 |
|---|
| SMILES | COc1ccc2c3c1OC1C(O)C=CC4C(C2)N(C)CCCC341 |
|---|
| InChI Key | RQNPFPUGUPMGRD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundsazepanescoumaranshydrocarbon derivativesorganopnictogen compoundsoxacyclic compoundssecondary alcoholstetralinstrialkylamines |
|---|
| Substituents | tetralinphenol etheretheralkyl aryl etheraromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundtertiary amineorganoheterocyclic compoundcoumaranalcoholphenanthreneazacycletertiary aliphatic amineoxacycleazepaneorganic oxygen compoundanisolesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
