| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:36 UTC |
|---|
| Update Date | 2025-03-21 18:03:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00044813 |
|---|
| Frequency | 83.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H17N5O7 |
|---|
| Molecular Mass | 355.1128 |
|---|
| SMILES | CN(C)c1nc(=O)c2c(=O)[nH]c(=O)n(C3OC(CO)C(O)C3O)c2[nH]1 |
|---|
| InChI Key | KSUAAVPOIDOEGQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | amines |
|---|
| Direct Parent | dialkylarylamines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aminopyrimidines and derivativesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspyrimidonessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | lactammonosaccharidepyrimidonepyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundorganopnictogen compounddialkylarylamineprimary alcoholorganoheterocyclic compoundalcoholvinylogous amidecarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundaminopyrimidineoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
