| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:36 UTC |
|---|
| Update Date | 2025-03-21 18:03:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00044815 |
|---|
| Frequency | 75.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14O4 |
|---|
| Molecular Mass | 282.0892 |
|---|
| SMILES | COc1ccc(-c2coc3c(OC)cccc3c2=O)cc1 |
|---|
| InChI Key | YAJATFCUENCKCU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflav-2-enes |
|---|
| Direct Parent | isoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisoleschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonoidsmethoxybenzenesorganic oxidesoxacyclic compoundsphenoxy compoundspyranones and derivatives |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-benzopyranalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundisoflavonebenzopyranheteroaromatic compoundmethoxybenzeneoxacycleorganic oxygen compoundpyrananisolehydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|
