| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:37 UTC |
|---|
| Update Date | 2025-03-21 18:03:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00044820 |
|---|
| Frequency | 75.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H32ClN3O2 |
|---|
| Molecular Mass | 477.2183 |
|---|
| SMILES | CN(C)C(=O)C(CCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccccc1)c1cccnc1 |
|---|
| InChI Key | LMBONBBMDPKPAV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | phenylpiperidines |
|---|
| Direct Parent | phenylpiperidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaryl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeschlorobenzenesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmethylpyridinesn-acyl aminesorganic oxidesorganochloridesorganopnictogen compoundsphenylacetamidestertiary alcoholstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesorganochloridecarboxylic acid derivativeorganohalogen compoundorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundphenylacetamidetertiary aminearyl chloridechlorobenzenealcoholazacycleheteroaromatic compoundtertiary aliphatic aminehydroxypyridinemethylpyridinecarboxamide groupn-acyl-aminearyl halidetertiary alcoholpyridineorganic oxygen compoundphenylpiperidinehydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
|---|
