| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-20 23:52:37 UTC | 
|---|
| Update Date | 2025-03-21 18:03:32 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID00044850 | 
|---|
| Frequency | 75.3 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C9H10O6 | 
|---|
| Molecular Mass | 214.0477 | 
|---|
| SMILES | O=C(O)CC(O)c1cc(O)c(O)c(O)c1 | 
|---|
| InChI Key | NZYRQYUHLXQQMR-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | phenylpropanoids and polyketides | 
|---|
| Class | phenylpropanoic acids | 
|---|
| Subclass  | phenylpropanoic acids | 
|---|
| Direct Parent  | phenylpropanoic acids | 
|---|
| Geometric Descriptor  | aromatic homomonocyclic compounds | 
|---|
| Alternative Parents  | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaromatic alcoholsbenzene and substituted derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidespyrogallols and derivativessecondary alcohols | 
|---|
| Substituents  | aromatic alcoholalcoholmonocyclic benzene moietycarbonyl groupcarboxylic acidpyrogallol derivative3-phenylpropanoic-acidbenzenetriol1-hydroxy-2-unsubstituted benzenoidhydroxy acid1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativearomatic homomonocyclic compoundbeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compound | 
|---|