| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:37 UTC |
|---|
| Update Date | 2025-03-21 18:03:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00044859 |
|---|
| Frequency | 75.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H14N2O6 |
|---|
| Molecular Mass | 234.0852 |
|---|
| SMILES | CC(=O)NC1C(N=O)OC(CO)C(O)C1O |
|---|
| InChI Key | IVXIOXCWPZKIML-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesc-nitroso compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspropargyl-type 1,3-dipolar organic compoundssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupmonosaccharidecarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholorganic nitroso compoundorganic 1,3-dipolar compoundcarboxamide groupoxacyclesecondary carboxylic acid amidesecondary alcoholc-nitroso compoundhydrocarbon derivativeorganic nitrogen compound |
|---|
