| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:38 UTC |
|---|
| Update Date | 2025-03-21 18:03:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00044884 |
|---|
| Frequency | 75.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H26N2O6 |
|---|
| Molecular Mass | 306.1791 |
|---|
| SMILES | CC(=O)NCCCCCNCC1(O)OC(CO)C(O)C1O |
|---|
| InChI Key | CWYJGNMZIHSBJY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativescarbonyl compoundscarboxylic acids and derivativesdialkylamineshemiacetalshydrocarbon derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | carbonyl groupamino acid or derivativesmonosaccharidecarboxylic acid derivativeorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalprimary alcoholorganoheterocyclic compoundacetamidealcoholsecondary aliphatic aminetetrahydrofuransecondary aminecarboxamide groupoxacyclesecondary carboxylic acid amidesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamine |
|---|
