| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-20 23:52:39 UTC | 
|---|
| Update Date | 2025-03-21 18:03:33 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID00044912 | 
|---|
| Frequency | 75.2 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C3H8O9P2 | 
|---|
| Molecular Mass | 249.9644 | 
|---|
| SMILES | O=C(O)C(COP(=O)(O)O)O[PH](=O)O | 
|---|
| InChI Key | VOBBBXHCJJGMAU-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organic oxygen compounds | 
|---|
| Class | organooxygen compounds | 
|---|
| Subclass  | carbohydrates and carbohydrate conjugates | 
|---|
| Direct Parent  | sugar acids and derivatives | 
|---|
| Geometric Descriptor  | aliphatic acyclic compounds | 
|---|
| Alternative Parents  | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxides | 
|---|
| Substituents  | aliphatic acyclic compoundcarbonyl groupcarboxylic acidcarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesphosphoric acid esterglyceric_acidmonoalkyl phosphatehydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate | 
|---|