| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:46 UTC |
|---|
| Update Date | 2025-03-21 18:03:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00045226 |
|---|
| Frequency | 74.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H7NO5S |
|---|
| Molecular Mass | 217.0045 |
|---|
| SMILES | O=C(O)c1ccc(NS(=O)(=O)O)cc1 |
|---|
| InChI Key | HLIYJBPIVVVYRR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | sulfanilides |
|---|
| Direct Parent | sulfanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzoic acidsbenzoyl derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundssulfuric acid monoamides |
|---|
| Substituents | carboxylic acidorganic sulfuric acid or derivativesbenzoylbenzoic acid or derivativescarboxylic acid derivativearomatic homomonocyclic compoundsulfanilideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundsulfuric acid monoamideorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundbenzoic acidorganooxygen compound |
|---|
