| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:48 UTC |
|---|
| Update Date | 2025-03-21 18:03:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00045313 |
|---|
| Frequency | 74.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N2O6 |
|---|
| Molecular Mass | 258.0852 |
|---|
| SMILES | Nc1c(C(=O)O)ccn1C1OC(CO)C(O)C1O |
|---|
| InChI Key | PQDCOTMMSDTQKR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrroles |
|---|
| Subclass | pyrrole carboxylic acids and derivatives |
|---|
| Direct Parent | pyrrole carboxylic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acidsazacyclic compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminessecondary alcoholssubstituted pyrrolestetrahydrofuransvinylogous amides |
|---|
| Substituents | carboxylic acidaromatic heteromonocyclic compoundamino acid or derivativesamino acidmonosaccharidesubstituted pyrrolecarboxylic acid derivativesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundprimary alcoholalcoholvinylogous amideazacycletetrahydrofuranheteroaromatic compoundoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundpyrrole-3-carboxylic acidamineorganooxygen compound |
|---|