| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:50 UTC |
|---|
| Update Date | 2025-03-21 18:03:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00045394 |
|---|
| Frequency | 74.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13N3O5 |
|---|
| Molecular Mass | 243.0855 |
|---|
| SMILES | NC(=O)c1ccn(C2OC(CO)C(O)C2O)n1 |
|---|
| InChI Key | OCPXZZGFLZCBGH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrazole ribonucleosides and ribonucleotides |
|---|
| Subclass | pyrazole ribonucleosides and ribonucleotides |
|---|
| Direct Parent | pyrazole ribonucleosides and ribonucleotides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-heteroaryl carboxamidesazacyclic compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary carboxylic acid amidespyrazolessecondary alcoholstetrahydrofurans |
|---|
| Substituents | primary carboxylic acid amidearomatic heteromonocyclic compoundmonosaccharidecarboxylic acid derivative2-heteroaryl carboxamidepyrazole1-ribofuranosylpyrazolesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundazolealcoholazacycletetrahydrofuranheteroaromatic compoundcarboxamide groupoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|