| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:51 UTC |
|---|
| Update Date | 2025-03-21 18:03:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00045427 |
|---|
| Frequency | 74.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H15NO8 |
|---|
| Molecular Mass | 265.0798 |
|---|
| SMILES | NC1C(O)CC(O)(C(=O)O)OC1C(=O)C(O)CO |
|---|
| InChI Key | PGULXJVLBMSSIM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | c-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acyloinsalpha hydroxy acids and derivativesbeta-hydroxy ketonescarboxylic acidsdelta amino acids and derivativeshemiacetalshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | beta-hydroxy ketonecarbonyl groupcarboxylic acidalpha-hydroxy acidmonosaccharidecarboxylic acid derivativepyran carboxylic acidketoneorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaldelta amino acid or derivativesoxaneprimary alcoholorganoheterocyclic compoundc-glucuronidealcoholpyran carboxylic acid or derivativeshydroxy acidoxacyclemonocarboxylic acid or derivativespyranacyloinsecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compound |
|---|
