| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:52:51 UTC |
|---|
| Update Date | 2025-03-21 18:03:37 UTC |
|---|
| HMDB ID | HMDB0135378 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00045430 |
|---|
| Name | {4-[3-(2,5-dihydroxyphenyl)-3-oxopropyl]phenyl}oxidanesulfonic acid |
|---|
| Frequency | 74.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O7S |
|---|
| Molecular Mass | 338.046 |
|---|
| SMILES | O=C(CCc1ccc(OS(=O)(=O)O)cc1)c1cc(O)ccc1O |
|---|
| InChI Key | YZGWGKYYHWFRRB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | chalcones and dihydrochalcones |
|---|
| Direct Parent | 2'-hydroxy-dihydrochalcones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl-phenylketonesaryl alkyl ketonesbenzoyl derivativesbutyrophenonescinnamylphenolshydrocarbon derivativeshydroquinonesorganic oxidesorganooxygen compoundsphenoxy compoundsphenylsulfatessulfuric acid monoestersvinylogous acids |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoester2'-hydroxy-dihydrochalconearyl alkyl ketonebenzoyl1-hydroxy-2-unsubstituted benzenoidcinnamylphenolketonephenylsulfateorganic oxidearylsulfateorganic sulfuric acid or derivativesphenylketonehydroquinonebutyrophenonearomatic homomonocyclic compoundvinylogous acidorganic oxygen compoundsulfate-esterphenolhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esteralkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|