| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:52:57 UTC |
|---|
| Update Date | 2025-03-21 18:03:39 UTC |
|---|
| HMDB ID | HMDB0255287 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00045654 |
|---|
| Name | N(6),O(2)-Dimethyladenosine |
|---|
| Frequency | 73.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H17N5O4 |
|---|
| Molecular Mass | 295.1281 |
|---|
| SMILES | CNc1ncnc2c1ncn2C1OC(CO)C(O)C1OC |
|---|
| InChI Key | GRYSXUXXBDSYRT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine nucleosides |
|---|
| Direct Parent | purine nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl ethersheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonosaccharidesn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsprimary alcoholspurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholssecondary alkylarylaminestetrahydrofurans |
|---|
| Substituents | ethermonosaccharideimidazopyrimidinedialkyl etherpyrimidinesaccharidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranpurine nucleosideheteroaromatic compoundsecondary aminesecondary aliphatic/aromatic amineoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativepurineorganic nitrogen compoundorganooxygen compoundamine |
|---|