| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:58 UTC |
|---|
| Update Date | 2025-03-21 18:03:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00045689 |
|---|
| Frequency | 81.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10N2O3 |
|---|
| Molecular Mass | 206.0691 |
|---|
| SMILES | O=C1NC(=O)C(Cc2cccc(O)c2)N1 |
|---|
| InChI Key | SIDWPXBEWSODDF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azolidines |
|---|
| Subclass | imidazolidines |
|---|
| Direct Parent | hydantoins |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalpha amino acidsazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdicarboximideshydrocarbon derivativesimidazolidinonesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativescarboxylic acid derivativeorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximidecarbonic acid derivativeazacycle1-hydroxy-4-unsubstituted benzenoidorganic oxygen compoundhydantoinphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
