| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:01 UTC |
|---|
| Update Date | 2025-03-21 18:03:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00045797 |
|---|
| Frequency | 73.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H16N2O2 |
|---|
| Molecular Mass | 220.1212 |
|---|
| SMILES | CC(=O)N1CCN(c2ccccc2O)CC1 |
|---|
| InChI Key | RJJQNUAKCNYSTA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetamidesamino acids and derivativesaniline and substituted anilinesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylarylamineshydrocarbon derivativesn-arylpiperazinesorganic oxidesorganopnictogen compoundstertiary carboxylic acid amideso-aminophenols |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundamino acid or derivatives1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxidetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compounddialkylarylaminetertiary amineacetamideazacycleaniline or substituted anilinesaminophenol1-hydroxy-4-unsubstituted benzenoidcarboxamide groupphenylpiperazineorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundo-aminophenolaminen-arylpiperazineorganooxygen compound |
|---|
