| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:02 UTC |
|---|
| Update Date | 2025-03-21 18:03:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00045859 |
|---|
| Frequency | 73.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H22N2O |
|---|
| Molecular Mass | 234.1732 |
|---|
| SMILES | CCNCC(=O)Nc1c(C)cccc1C(C)C |
|---|
| InChI Key | LCAARDUGFQBIPU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid amides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsanilidescarbonyl compoundscarboxylic acids and derivativescumenesdialkylamineshydrocarbon derivativesn-arylamidesorganic oxidesorganopnictogen compoundsphenylpropanessecondary carboxylic acid amidestoluenes |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupn-arylamidephenylpropaneorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundcumenesecondary aliphatic aminealpha-amino acid amidesecondary aminecarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundtolueneorganooxygen compoundamine |
|---|
