| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:04 UTC |
|---|
| Update Date | 2025-03-21 18:03:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00045913 |
|---|
| Frequency | 73.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H28N2O13 |
|---|
| Molecular Mass | 456.1591 |
|---|
| SMILES | NC(CC(=O)NC1OC(CO)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O)C(=O)O |
|---|
| InChI Key | ZWDHFRWCDUVGLG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | saccharolipids |
|---|
| Subclass | saccharolipids |
|---|
| Direct Parent | saccharolipids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalpha amino acidsasparagine and derivativescarbonyl compoundscarboxylic acidsfatty acyl glycosidesheterocyclic fatty acidshydrocarbon derivativeshydroxy fatty acidsmonoalkylaminesmonocarboxylic acids and derivativesmonosaccharidesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidesshort-chain hydroxy acids and derivatives |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidshort-chain hydroxy acidheterocyclic fatty acidfatty amidemonosaccharidefatty acidalpha-amino acid or derivativescarboxylic acid derivativesaccharideorganic oxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydroxy fatty acidasparagine or derivativesoxaneprimary alcoholorganoheterocyclic compoundalcoholfatty n-acyl glycosidecarboxamide groupn-acyl-amineoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundsaccharolipidorganooxygen compound |
|---|
