| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:53:06 UTC |
|---|
| Update Date | 2025-03-21 18:03:42 UTC |
|---|
| HMDB ID | HMDB0125107 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00045978 |
|---|
| Name | (3,4,5,6-tetrahydroxyoxan-2-yl)methyl 4-hydroxybenzoate |
|---|
| Frequency | 73.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16O8 |
|---|
| Molecular Mass | 300.0845 |
|---|
| SMILES | O=C(OCC1OC(O)C(O)C(O)C1O)c1ccc(O)cc1 |
|---|
| InChI Key | KBOQXAVWJMJUBC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | p-hydroxybenzoic acid alkyl esters |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzoyl derivativescarboxylic acid estershemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | aromatic heteromonocyclic compoundbenzoyl1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativesaccharideorganic oxidehemiacetaloxaneorganoheterocyclic compoundalcoholp-hydroxybenzoic acid alkyl esteroxacyclemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholphenolhydrocarbon derivativeorganooxygen compound |
|---|
