| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:07 UTC |
|---|
| Update Date | 2025-03-21 18:03:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00046051 |
|---|
| Frequency | 72.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O4 |
|---|
| Molecular Mass | 254.0579 |
|---|
| SMILES | O=C(O)C(=O)c1cccc(C(=O)c2ccccc2)c1 |
|---|
| InChI Key | KSKYYGJCWINFJS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha-keto acids and derivativesaryl ketonesaryl-phenylketonesbenzoyl derivativescarboxylic acidsdiphenylmethaneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | diphenylmethanecarbonyl groupcarboxylic acidaryl-phenylketonebenzoylcarboxylic acid derivativebenzophenoneketonearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundketo acidalpha-keto acidhydrocarbon derivativeorganooxygen compoundaryl ketone |
|---|
