| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:09 UTC |
|---|
| Update Date | 2025-03-21 18:03:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00046123 |
|---|
| Frequency | 72.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N5O5P |
|---|
| Molecular Mass | 315.0733 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1CC(O)C(CP(=O)(O)O)O1 |
|---|
| InChI Key | JBNRFWOJDSNVGG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | 2',5'-dideoxyribonucleosides |
|---|
| Subclass | 2',5'-dideoxyribonucleosides |
|---|
| Direct Parent | 2',5'-dideoxyribonucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganic phosphonic acids and derivativesorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | 2',5'-dideoxyribonucleosidemonosaccharideimidazopyrimidinepyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundorganophosphorus compoundimidolactamorganophosphonic acid derivativeorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|
