| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:10 UTC |
|---|
| Update Date | 2025-03-21 18:03:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00046179 |
|---|
| Frequency | 72.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H7NO5 |
|---|
| Molecular Mass | 173.0324 |
|---|
| SMILES | O=C1CC(O)(C(=O)O)CC(=O)N1 |
|---|
| InChI Key | AYOGMPKWZYZTIZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | piperidinecarboxylic acids and derivatives |
|---|
| Direct Parent | piperidinecarboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acidsdelta lactamsdicarboximideshydrocarbon derivativesmonocarboxylic acids and derivativesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperidinedionestertiary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidalpha-hydroxy acidcarboxylic acid derivativecarboxylic acid imide, n-unsubstitutedorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidinedionepiperidinonepiperidinecarboxylic aciddicarboximidealcoholazacyclehydroxy acidcarboxylic acid imidedelta-lactamtertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
