| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:10 UTC |
|---|
| Update Date | 2025-03-21 18:03:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00046180 |
|---|
| Frequency | 72.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H13IO3 |
|---|
| Molecular Mass | 355.9909 |
|---|
| SMILES | OCCc1ccc(Oc2ccc(O)cc2)c(I)c1 |
|---|
| InChI Key | NWGNKFQRSSQLAM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalcohols and polyolsaryl iodidesdiarylethershydrocarbon derivativesiodobenzenesorganoiodidesphenol ethersphenoxy compoundstyrosols and derivatives |
|---|
| Substituents | diaryl etheralcoholphenol etherether1-hydroxy-2-unsubstituted benzenoidorganohalogen compoundiodobenzeneorganoiodidearyl halidearomatic homomonocyclic compoundorganic oxygen compoundphenolhydrocarbon derivativearyl iodidetyrosol derivativehalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|
