| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:12 UTC |
|---|
| Update Date | 2025-03-21 18:03:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00046227 |
|---|
| Frequency | 72.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H11Cl3O4 |
|---|
| Molecular Mass | 371.9723 |
|---|
| SMILES | O=C(O)c1ccccc1C(=O)OC(c1ccccc1)C(Cl)(Cl)Cl |
|---|
| InChI Key | AQGKZXJWYMTSFW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acid esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsalkyl chloridesbenzoic acidsbenzoyl derivativesbenzyloxycarbonylscarboxylic acid estersdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganochloridesorganooxygen compounds |
|---|
| Substituents | benzyloxycarbonylcarboxylic acidalkyl chlorideorganochloridebenzoylbenzoate estercarboxylic acid derivativeorganohalogen compoundaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundcarboxylic acid esterdicarboxylic acid or derivativesalkyl halidehydrocarbon derivative1-carboxy-2-haloaromatic compoundbenzoic acidorganooxygen compound |
|---|