| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:15 UTC |
|---|
| Update Date | 2025-03-21 18:03:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00046376 |
|---|
| Frequency | 72.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H25NO3 |
|---|
| Molecular Mass | 339.1834 |
|---|
| SMILES | CCOC(=O)N1CCC(C(O)(c2ccccc2)c2ccccc2)CC1 |
|---|
| InChI Key | QRIZUOSGAPMNLH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsazacyclic compoundscarbamate esterscarbonyl compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperidinecarboxylic acidspiperidinestertiary alcohols |
|---|
| Substituents | aromatic alcoholalcoholdiphenylmethanecarbonyl groupcarbonic acid derivativearomatic heteromonocyclic compoundazacyclecarbamic acid estertertiary alcoholorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativepiperidinecarboxylic acidorganic nitrogen compoundpiperidineorganoheterocyclic compoundorganooxygen compound |
|---|
