| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:20 UTC |
|---|
| Update Date | 2025-03-21 18:03:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00046568 |
|---|
| Frequency | 71.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H14O5 |
|---|
| Molecular Mass | 190.0841 |
|---|
| SMILES | CC(=O)C1(O)CC(O)C(O)C(O)C1 |
|---|
| InChI Key | IUIGCXCNXUZWIL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | cyclitols and derivativeshydrocarbon derivativesketonesorganic oxidestertiary alcohols |
|---|
| Substituents | carbonyl groupcyclohexanolcyclitol or derivativescyclic alcoholketonetertiary alcoholorganic oxidealiphatic homomonocyclic compoundhydrocarbon derivative |
|---|