| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:21 UTC |
|---|
| Update Date | 2025-03-21 18:03:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00046596 |
|---|
| Frequency | 71.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H8Cl4O2 |
|---|
| Molecular Mass | 299.9278 |
|---|
| SMILES | CC(=O)OC(c1ccc(Cl)cc1)C(Cl)(Cl)Cl |
|---|
| InChI Key | RBLRENIPDVSMGP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzyloxycarbonyls |
|---|
| Direct Parent | benzyloxycarbonyls |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl chloridesaryl chloridescarbonyl compoundscarboxylic acid esterschlorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochlorides |
|---|
| Substituents | benzyloxycarbonylaryl chloridechlorobenzenecarbonyl groupalkyl chlorideorganochloridecarboxylic acid derivativeorganohalogen compoundaryl halidearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esteralkyl halidehydrocarbon derivativehalobenzeneorganooxygen compound |
|---|
