| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-20 23:53:21 UTC | 
|---|
| Update Date | 2025-03-21 18:03:48 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID00046617 | 
|---|
| Frequency | 77.0 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C12H16N2O4 | 
|---|
| Molecular Mass | 252.111 | 
|---|
| SMILES | COC(=O)C(Cc1ccc(O)cc1)NC(=O)CN | 
|---|
| InChI Key | AEOOZNHTRCEWBN-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organic acids and derivatives | 
|---|
| Class | carboxylic acids and derivatives | 
|---|
| Subclass | amino acids, peptides, and analogues | 
|---|
| Direct Parent | peptides | 
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds | 
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acid estersalpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundsfatty acid estershydrocarbon derivativesmethyl estersmonoalkylaminesmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylalanine and derivativessecondary carboxylic acid amidestyrosine and derivatives | 
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl group1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativesalpha peptideorganic oxidemethyl esterorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativestyrosine or derivativesalpha-amino acid amidealpha-amino acid estern-acyl-alpha-amino acidcarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amidefatty acid estermonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundcarboxylic acid esterphenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound | 
|---|