| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:53:21 UTC |
|---|
| Update Date | 2025-03-21 18:03:48 UTC |
|---|
| HMDB ID | HMDB0094673 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00046620 |
|---|
| Name | Cyclo(Leu-Phe) |
|---|
| Frequency | 468.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H20N2O2 |
|---|
| Molecular Mass | 260.1525 |
|---|
| SMILES | CC(C)CC1NC(=O)C(Cc2ccccc2)NC1=O |
|---|
| InChI Key | QPDMOMIYLJMOQJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2,5-dioxopiperazinesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativeslactamsorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouplactamaromatic heteromonocyclic compoundazacyclecarboxamide group2,5-dioxopiperazinesecondary carboxylic acid amideorganic oxideorganic oxygen compounddioxopiperazinepiperazine1,4-diazinaneorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|
