| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:53:23 UTC |
|---|
| Update Date | 2025-03-21 18:03:48 UTC |
|---|
| HMDB ID | HMDB0248472 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00046694 |
|---|
| Name | Anti-phosphotyrosine |
|---|
| Frequency | 71.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12NO6P |
|---|
| Molecular Mass | 261.0402 |
|---|
| SMILES | O=C(O)C(Cc1ccc(O)cc1)NP(=O)(O)O |
|---|
| InChI Key | HBOCNGZYIAZFSU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | tyrosine and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoramidesorganonitrogen compoundsorganopnictogen compoundsphenylalanine and derivativesphenylpropanoic acids |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acid1-hydroxy-2-unsubstituted benzenoidorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganic phosphoric acid amideamphetamine or derivativestyrosine or derivativesaromatic homomonocyclic compoundmonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compound |
|---|
