| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:28 UTC |
|---|
| Update Date | 2025-03-21 18:03:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00046885 |
|---|
| Frequency | 71.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H26N4OS |
|---|
| Molecular Mass | 394.1827 |
|---|
| SMILES | CC(=O)NCCCN1CCN(C2=Nc3ccccc3Sc3ccccc32)CC1 |
|---|
| InChI Key | MDXQQJMDJUMYHN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzothiazepines |
|---|
| Subclass | dibenzothiazepines |
|---|
| Direct Parent | dibenzothiazepines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetamidesamidinesamino acids and derivativesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativesdiarylthioethershydrocarbon derivativesimidolactamsn-alkylpiperazinesorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundssecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | carbonyl groupamino acid or derivativesamidinecarboxylic acid derivativearyl thioetherpropargyl-type 1,3-dipolar organic compounddibenzothiazepineorganic oxidepiperazinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundimidolactamtertiary amineacetamidediarylthioetherazacyclen-alkylpiperazinetertiary aliphatic amineorganic 1,3-dipolar compoundcarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundthioether1,4-diazinanehydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|