| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:29 UTC |
|---|
| Update Date | 2025-03-21 18:03:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00046922 |
|---|
| Frequency | 71.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H4N2O7S |
|---|
| Molecular Mass | 235.9739 |
|---|
| SMILES | O=C(OS(=O)(=O)O)c1c[nH]c(=O)[nH]c1=O |
|---|
| InChI Key | FHOZFBKHWAZWDN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidinecarboxylic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrimidonessulfuric acid monoestersvinylogous amides |
|---|
| Substituents | vinylogous amidesulfuric acid monoestercarbonic acid derivativelactamorganic sulfuric acid or derivativesaromatic heteromonocyclic compoundazacycleheteroaromatic compoundpyrimidonepyrimidine-5-carboxylic acidcarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
|---|
