| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:32 UTC |
|---|
| Update Date | 2025-03-21 18:03:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00047060 |
|---|
| Frequency | 70.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H11Cl2NO2 |
|---|
| Molecular Mass | 295.0167 |
|---|
| SMILES | CC(=O)Nc1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
|---|
| InChI Key | DKGLREXAQONRLO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesacetanilidesaryl chloridescarbonyl compoundscarboxylic acids and derivativesdiarylethersdichlorobenzeneshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganochloridesorganopnictogen compoundsphenol ethersphenoxy compoundssecondary carboxylic acid amides |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupethern-acetylarylamineorganochloriden-arylamidecarboxylic acid derivativeorganohalogen compound1,3-dichlorobenzeneorganic oxideorganonitrogen compoundorganopnictogen compoundacetamidearyl chloridechlorobenzeneacetanilidecarboxamide grouparyl halidearomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|
