| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:32 UTC |
|---|
| Update Date | 2025-03-21 18:03:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00047072 |
|---|
| Frequency | 70.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H11N2O6P |
|---|
| Molecular Mass | 214.0355 |
|---|
| SMILES | CN(CC(=O)O)C(O)NP(=O)(O)O |
|---|
| InChI Key | KJEOFWBSMSNLLV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkanolaminescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoramidesorganonitrogen compoundsorganopnictogen compoundsorthocarboxylic acid derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorthocarboxylic acid derivativeorganic phosphoric acid derivativeorganic phosphoric acid amideorganooxygen compoundalkanolamine |
|---|
