| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:53:36 UTC |
|---|
| Update Date | 2025-03-21 18:03:54 UTC |
|---|
| HMDB ID | HMDB0304062 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00047206 |
|---|
| Name | 2-carboxy-L-threo-pentonate |
|---|
| Frequency | 70.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H10O8 |
|---|
| Molecular Mass | 210.0376 |
|---|
| SMILES | O=C(O)C(O)(C(=O)O)C(O)C(O)CO |
|---|
| InChI Key | CQIRJDZGDXTXKF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | beta hydroxy acids and derivatives |
|---|
| Direct Parent | beta hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesbranched fatty acidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativeshydroxy fatty acidsmonosaccharidesorganic oxidesprimary alcoholssecondary alcoholsshort-chain hydroxy acids and derivativestertiary alcohols |
|---|
| Substituents | alcoholfatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidalpha-hydroxy acidmonosaccharidefatty acidcarboxylic acid derivativebranched fatty acidbeta-hydroxy acidtertiary alcoholsaccharideorganic oxideorganic oxygen compoundsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativehydroxy fatty acidprimary alcoholorganooxygen compound |
|---|