| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:41 UTC |
|---|
| Update Date | 2025-03-21 18:03:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00047399 |
|---|
| Frequency | 70.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C2H4Cl2O8P2 |
|---|
| Molecular Mass | 287.8758 |
|---|
| SMILES | O=C(OP(=O)(O)O)C(Cl)(Cl)P(=O)(O)O |
|---|
| InChI Key | WKJFFJULVOMEFB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | acyl monophosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl chloridesalpha-halocarboxylic acid derivativescarbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphonic acids and derivativesorganic phosphoric acids and derivativesorganochloridesorganophosphorus compoundsorganopnictogen compounds |
|---|
| Substituents | alpha-halocarboxylic acid or derivativesaliphatic acyclic compoundcarbonyl groupalkyl chlorideorganochlorideacyl monophosphatecarboxylic acid derivativeorganohalogen compoundalpha-halocarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganopnictogen compoundorganophosphorus compoundalkyl halidehydrocarbon derivativeorganophosphonic acid derivativeorganooxygen compound |
|---|
