| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:41 UTC |
|---|
| Update Date | 2025-03-21 18:03:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00047421 |
|---|
| Frequency | 70.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10O4 |
|---|
| Molecular Mass | 206.0579 |
|---|
| SMILES | Cc1ccc(C(=O)CC(=O)C(=O)O)cc1 |
|---|
| InChI Key | HTYHIFXQHMFHEB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativesaryl alkyl ketonesbenzoyl derivativesbutyrophenonescarboxylic acidsgamma-keto acids and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidestoluenes |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidaryl alkyl ketonebenzoylalpha-hydroxy ketonecarboxylic acid derivativegamma-keto acidbutyrophenonearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesketo acidalpha-keto acidhydrocarbon derivativebenzenoidtoluenealkyl-phenylketone |
|---|
