| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:53:43 UTC |
|---|
| Update Date | 2025-03-21 18:03:57 UTC |
|---|
| HMDB ID | HMDB0304928 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00047499 |
|---|
| Name | 3- Hydroxyindolin-2-one-sulfate |
|---|
| Frequency | 77.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H7NO5S |
|---|
| Molecular Mass | 229.0045 |
|---|
| SMILES | O=C1Nc2ccccc2C1OS(=O)(=O)O |
|---|
| InChI Key | HLYCAHONCGGOOJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl sulfatesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesindolineslactamsorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonyl grouplactamindolecarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundalkyl sulfateorganonitrogen compoundorganopnictogen compounddihydroindoleorganic sulfuric acid or derivativesazacyclecarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundsulfate-esterhydrocarbon derivativebenzenoidorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
|---|
