| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:43 UTC |
|---|
| Update Date | 2025-03-21 18:03:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00047513 |
|---|
| Frequency | 70.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H23N3O3 |
|---|
| Molecular Mass | 293.1739 |
|---|
| SMILES | Nc1ccc(C(=O)N2CCN(CCOCCO)CC2)cc1 |
|---|
| InChI Key | FXFQXKVYNYTTQD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsamino acids and derivativesazacyclic compoundsbenzoyl derivativescarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesn-alkylpiperazinesorganic oxidesorganopnictogen compoundsprimary aminestertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | etheraromatic heteromonocyclic compoundamino acid or derivativesbenzoylcarboxylic acid derivativedialkyl etherbenzamideorganic oxidepiperazinetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundtertiary amineorganoheterocyclic compoundalcoholazacyclen-alkylpiperazinetertiary aliphatic aminecarboxamide grouporganic oxygen compound1,4-diazinanehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
