| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:46 UTC |
|---|
| Update Date | 2025-03-21 18:03:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00047621 |
|---|
| Frequency | 69.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H12O5 |
|---|
| Molecular Mass | 248.0685 |
|---|
| SMILES | Oc1cc(O)c(Cc2ccc(O)c(O)c2)c(O)c1 |
|---|
| InChI Key | XEHNDURPBDSXOK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidshydrocarbon derivativesorganooxygen compoundsphloroglucinols and derivatives |
|---|
| Substituents | diphenylmethanebenzenetriol1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidphloroglucinol derivativearomatic homomonocyclic compoundorganic oxygen compoundphenolhydrocarbon derivativeorganooxygen compound |
|---|
