| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:47 UTC |
|---|
| Update Date | 2025-03-21 18:03:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00047632 |
|---|
| Frequency | 69.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H22N2O6P+ |
|---|
| Molecular Mass | 285.121 |
|---|
| SMILES | C[N+](C)(C)CCOP(=O)(O)OCCC(N)C(=O)O |
|---|
| InChI Key | OLCFHDLDYFOMCF-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | quaternary ammonium salts |
|---|
| Direct Parent | phosphocholines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidsaminescarbonyl compoundscarboxylic acidsdialkyl phosphatesfatty acids and conjugateshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsshort-chain hydroxy acids and derivativestetraalkylammonium salts |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidfatty acidalpha-amino acid or derivativescarboxylic acid derivativeorganic oxidealpha-amino acidorganopnictogen compoundorganic cationorganic salttetraalkylammonium saltphosphocholinedialkyl phosphatemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid esterhydrocarbon derivativeprimary aliphatic amineorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
