| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:48 UTC |
|---|
| Update Date | 2025-03-21 18:03:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00047677 |
|---|
| Frequency | 81.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H15NO5 |
|---|
| Molecular Mass | 205.095 |
|---|
| SMILES | OCC(O)C(O)C(O)C1CCC(O)=N1 |
|---|
| InChI Key | KKUOSCCLXIHLKF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscyclic carboximidic acidshydrocarbon derivativesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholspropargyl-type 1,3-dipolar organic compoundspyrrolinessecondary alcohols |
|---|
| Substituents | alcoholazacyclemonosaccharideorganic 1,3-dipolar compoundpropargyl-type 1,3-dipolar organic compoundpyrrolinealiphatic heteromonocyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundprimary alcoholcyclic carboximidic acidorganoheterocyclic compound |
|---|