| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:49 UTC |
|---|
| Update Date | 2025-03-21 18:03:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00047714 |
|---|
| Frequency | 69.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8O5S |
|---|
| Molecular Mass | 216.0092 |
|---|
| SMILES | O=C(O)Cc1ccc(O)c(S(=O)O)c1 |
|---|
| InChI Key | DJODGACXXPXEJW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Direct Parent | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganosulfur compoundssulfinic acids |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidsulfinic acid derivative1-hydroxy-2-unsubstituted benzenoidorganosulfur compoundcarboxylic acid derivativesulfinic acidaromatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganooxygen compound |
|---|
