| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:49 UTC |
|---|
| Update Date | 2025-03-21 18:03:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00047721 |
|---|
| Frequency | 69.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H18O4 |
|---|
| Molecular Mass | 334.1205 |
|---|
| SMILES | Oc1ccc(C2CC(c3ccc(O)cc3)c3ccc(O)cc3O2)cc1 |
|---|
| InChI Key | PTCDNNPAMBNOHT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 7-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids4'-hydroxyflavonoidsalkyl aryl ethersbenzene and substituted derivativesflavanshydrocarbon derivativesneoflavansoxacyclic compounds |
|---|
| Substituents | neoflavanmonocyclic benzene moietyetherbenzopyran1-benzopyranflavan1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheroxacycleorganic oxygen compoundaromatic heteropolycyclic compound7-hydroxyflavonoidchromane4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidneoflavonoid skeletonorganoheterocyclic compoundorganooxygen compound |
|---|
