| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:51 UTC |
|---|
| Update Date | 2025-03-21 18:04:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00047816 |
|---|
| Frequency | 69.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H24O6 |
|---|
| Molecular Mass | 336.1573 |
|---|
| SMILES | CC(C(=O)O)c1ccc(OC2OC(C(=O)O)C(C)C(C)C2C)cc1 |
|---|
| InChI Key | UFZXQFYWLWFWEL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupcarboxylic acidpyran carboxylic acid or derivativesaromatic heteromonocyclic compoundcarboxylic acid derivativepyran carboxylic acidoxacycleorganic oxideorganic oxygen compound2-phenylpropanoic-acidacetalpyrandicarboxylic acid or derivativeshydrocarbon derivativebenzenoidphenoxy compoundoxaneorganoheterocyclic compoundorganooxygen compound |
|---|
