| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:55 UTC |
|---|
| Update Date | 2025-03-21 18:04:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00047947 |
|---|
| Frequency | 69.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H15N4O8P |
|---|
| Molecular Mass | 338.0628 |
|---|
| SMILES | NC(=O)c1cnn(C2OC(COP(=O)(O)O)C(O)C2O)c1N |
|---|
| InChI Key | IKSLTBRNQKVDEI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsamino acids and derivativesazacyclic compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary aminesprimary carboxylic acid amidespyrazole ribonucleosides and ribonucleotidespyrazolessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | primary carboxylic acid amidearomatic heteromonocyclic compoundpentose phosphateamino acid or derivativespentose-5-phosphatecarboxylic acid derivativepyrazole1-ribofuranosylpyrazoleorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazole1,2-diolalcoholvinylogous amideazacycletetrahydrofuranheteroaromatic compoundcarboxamide groupoxacyclephosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphate |
|---|
