| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:53:57 UTC |
|---|
| Update Date | 2025-03-21 18:04:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00048042 |
|---|
| Frequency | 69.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H10ClN7 |
|---|
| Molecular Mass | 287.0686 |
|---|
| SMILES | Nc1nc(N)c2nc(-c3ccc(Cl)cc3)c(N)nc2n1 |
|---|
| InChI Key | UIECDPSZZDBSGD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl chloridesazacyclic compoundschlorobenzenesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganochloridesorganopnictogen compoundsprimary aminespyrazinespyrimidines and pyrimidine derivatives |
|---|
| Substituents | aryl chloridechlorobenzenemonocyclic benzene moietyazacycleorganochlorideheteroaromatic compoundpteridineorganohalogen compoundaryl halidepyrimidinearomatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundhalobenzeneimidolactamamine |
|---|